About (3R)-3-amino-2,3-dihydro-1,5-benzodiazepin-4-one
(3R)-3-amino-2,3-dihydro-1,5-benzodiazepin-4-one (PubChem CID 139702646) has the molecular formula C9H9N3O
and a molecular weight of 175.19 g/mol. Its IUPAC name is (3R)-3-amino-2,3-dihydro-1,5-benzodiazepin-4-one.
Molecular Properties
| Compound Name | (3R)-3-amino-2,3-dihydro-1,5-benzodiazepin-4-one |
| PubChem CID | 139702646 |
| Molecular Formula | C9H9N3O |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | (3R)-3-amino-2,3-dihydro-1,5-benzodiazepin-4-one |
| SMILES | N[C@@H]1CN=c2ccccc2=NC1=O |
| InChI | InChI=1S/C9H9N3O/c10-6-5-11-7-3-1-2-4-8(7)12-9(6)13/h1-4,6H,5,10H2/t6-/m1/s1 |
| InChIKey | VQGBCLUDPNPIPL-ZCFIWIBFSA-N |
| XLogP | -1.21 |
| TPSA | 67.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R)-3-amino-2,3-dihydro-1,5-benzodiazepin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-amino-2,3-dihydro-1,5-benzodiazepin-4-one?
The IUPAC name of (3R)-3-amino-2,3-dihydro-1,5-benzodiazepin-4-one (CID 139702646) is (3R)-3-amino-2,3-dihydro-1,5-benzodiazepin-4-one.
What is the SMILES notation for (3R)-3-amino-2,3-dihydro-1,5-benzodiazepin-4-one?
The canonical SMILES for (3R)-3-amino-2,3-dihydro-1,5-benzodiazepin-4-one is N[C@@H]1CN=c2ccccc2=NC1=O.
What is the InChIKey of (3R)-3-amino-2,3-dihydro-1,5-benzodiazepin-4-one?
The InChIKey is VQGBCLUDPNPIPL-ZCFIWIBFSA-N. The full InChI is InChI=1S/C9H9N3O/c10-6-5-11-7-3-1-2-4-8(7)12-9(6)13/h1-4,6H,5,10H2/t6-/m1/s1.
What are the key properties of (3R)-3-amino-2,3-dihydro-1,5-benzodiazepin-4-one?
(3R)-3-amino-2,3-dihydro-1,5-benzodiazepin-4-one has a molecular weight of 175.19 g/mol, XLogP of -1.21, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-amino-2,3-dihydro-1,5-benzodiazepin-4-one is sourced from PubChem (CID 139702646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).