C23H30Cl2N4O3 — CID 139703058
N-[4-(1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-3-yl)butyl]-4-nitrobenzamide;dihydrochloride (PubChem CID 139703058) has the molecular formula C23H30Cl2N4O3 and a molecular weight of 481.42 g/mol. Its IUPAC name is N-[4-(1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-3-yl)butyl]-4-nitrobenzamide;dihydrochloride.
| Compound Name | N-[4-(1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-3-yl)butyl]-4-nitrobenzamide;dihydrochloride |
|---|---|
| PubChem CID | 139703058 |
| Molecular Formula | C23H30Cl2N4O3 |
| Molecular Weight | 481.42 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | N-[4-(1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-3-yl)butyl]-4-nitrobenzamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NCCCCN1CCN2c3ccccc3CCC2C1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H28N4O3.2ClH/c28-23(19-8-10-20(11-9-19)27(29)30)24-13-3-4-14-25-15-16-26-21(17-25)12-7-18-5-1-2-6-22(18)26;;/h1-2,5-6,8-11,21H,3-4,7,12-17H2,(H,24,28);2*1H |
| InChIKey | VZOCIGCCRUJFPB-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.42 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|