C14H15N — CID 139703260
N,N-dimethyl-2-naphthalen-1-ylethenamine (PubChem CID 139703260) has the molecular formula C14H15N and a molecular weight of 197.28 g/mol. Its IUPAC name is N,N-dimethyl-2-naphthalen-1-ylethenamine.
| Compound Name | N,N-dimethyl-2-naphthalen-1-ylethenamine |
|---|---|
| PubChem CID | 139703260 |
| Molecular Formula | C14H15N |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | N,N-dimethyl-2-naphthalen-1-ylethenamine |
| SMILES | CN(C)C=Cc1cccc2ccccc12 |
| InChI | InChI=1S/C14H15N/c1-15(2)11-10-13-8-5-7-12-6-3-4-9-14(12)13/h3-11H,1-2H3 |
| InChIKey | OLUFGFRBSKAZRC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |