C20H25N3O3 — CID 139703273
N-(4-diazo-2,5-dipropoxycyclohexa-1,5-dien-1-yl)-4-methylbenzamide (PubChem CID 139703273) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is N-(4-diazo-2,5-dipropoxycyclohexa-1,5-dien-1-yl)-4-methylbenzamide.
| Compound Name | N-(4-diazo-2,5-dipropoxycyclohexa-1,5-dien-1-yl)-4-methylbenzamide |
|---|---|
| PubChem CID | 139703273 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | N-(4-diazo-2,5-dipropoxycyclohexa-1,5-dien-1-yl)-4-methylbenzamide |
| SMILES | CCCOC1=CC(NC(=O)c2ccc(C)cc2)=C(OCCC)CC1=[N+]=[N-] |
| InChI | InChI=1S/C20H25N3O3/c1-4-10-25-18-13-17(23-21)19(26-11-5-2)12-16(18)22-20(24)15-8-6-14(3)7-9-15/h6-9,12H,4-5,10-11,13H2,1-3H3,(H,22,24) |
| InChIKey | LWERPIKMYOFYMD-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|