C23H17Cl2NO2 — CID 139703911
3-(4-chlorophenyl)-N-[(2-chlorophenyl)methyl]-5-methyl-1-benzofuran-2-carboxamide (PubChem CID 139703911) has the molecular formula C23H17Cl2NO2 and a molecular weight of 410.30 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-[(2-chlorophenyl)methyl]-5-methyl-1-benzofuran-2-carboxamide.
| Compound Name | 3-(4-chlorophenyl)-N-[(2-chlorophenyl)methyl]-5-methyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 139703911 |
| Molecular Formula | C23H17Cl2NO2 |
| Molecular Weight | 410.30 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | 3-(4-chlorophenyl)-N-[(2-chlorophenyl)methyl]-5-methyl-1-benzofuran-2-carboxamide |
| SMILES | Cc1ccc2oc(C(=O)NCc3ccccc3Cl)c(-c3ccc(Cl)cc3)c2c1 |
| InChI | InChI=1S/C23H17Cl2NO2/c1-14-6-11-20-18(12-14)21(15-7-9-17(24)10-8-15)22(28-20)23(27)26-13-16-4-2-3-5-19(16)25/h2-12H,13H2,1H3,(H,26,27) |
| InChIKey | OYSSATYSUIEKIT-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.30 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |