C19H9Cl3F8N2S — CID 139704403
(Z)-3-[3,5-bis(trifluoromethyl)anilino]-4,4-difluoro-4-methylsulfanyl-2-(2,4,6-trichlorophenyl)but-2-enenitrile (PubChem CID 139704403) has the molecular formula C19H9Cl3F8N2S and a molecular weight of 555.71 g/mol. Its IUPAC name is (Z)-3-[3,5-bis(trifluoromethyl)anilino]-4,4-difluoro-4-methylsulfanyl-2-(2,4,6-trichlorophenyl)but-2-enenitrile.
| Compound Name | (Z)-3-[3,5-bis(trifluoromethyl)anilino]-4,4-difluoro-4-methylsulfanyl-2-(2,4,6-trichlorophenyl)but-2-enenitrile |
|---|---|
| PubChem CID | 139704403 |
| Molecular Formula | C19H9Cl3F8N2S |
| Molecular Weight | 555.71 g/mol |
| Exact Mass | 553.94 |
| IUPAC Name | (Z)-3-[3,5-bis(trifluoromethyl)anilino]-4,4-difluoro-4-methylsulfanyl-2-(2,4,6-trichlorophenyl)but-2-enenitrile |
| SMILES | CSC(F)(F)/C(Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)=C(/C#N)c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C19H9Cl3F8N2S/c1-33-19(29,30)16(12(7-31)15-13(21)5-10(20)6-14(15)22)32-11-3-8(17(23,24)25)2-9(4-11)18(26,27)28/h2-6,32H,1H3/b16-12+ |
| InChIKey | FVEDXLCNRLZXAC-FOWTUZBSSA-N |
| XLogP | 8.99 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.71 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|