C26H25NO2 — CID 139705688
2-(2,4,5-triethylanilino)anthracene-9,10-dione (PubChem CID 139705688) has the molecular formula C26H25NO2 and a molecular weight of 383.49 g/mol. Its IUPAC name is 2-(2,4,5-triethylanilino)anthracene-9,10-dione.
| Compound Name | 2-(2,4,5-triethylanilino)anthracene-9,10-dione |
|---|---|
| PubChem CID | 139705688 |
| Molecular Formula | C26H25NO2 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 2-(2,4,5-triethylanilino)anthracene-9,10-dione |
| SMILES | CCc1cc(CC)c(Nc2ccc3c(c2)C(=O)c2ccccc2C3=O)cc1CC |
| InChI | InChI=1S/C26H25NO2/c1-4-16-13-18(6-3)24(14-17(16)5-2)27-19-11-12-22-23(15-19)26(29)21-10-8-7-9-20(21)25(22)28/h7-15,27H,4-6H2,1-3H3 |
| InChIKey | OOGDPJPWKPYCKK-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|