About (2S)-4-[(7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)methylsulfinyl]-4-phenylbutan-2-ol
(2S)-4-[(7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)methylsulfinyl]-4-phenylbutan-2-ol (PubChem CID 139705703) has the molecular formula C20H30O2S
and a molecular weight of 334.52 g/mol. Its IUPAC name is (2S)-4-[(7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)methylsulfinyl]-4-phenylbutan-2-ol.
Molecular Properties
| Compound Name | (2S)-4-[(7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)methylsulfinyl]-4-phenylbutan-2-ol |
| PubChem CID | 139705703 |
| Molecular Formula | C20H30O2S |
| Molecular Weight | 334.52 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | (2S)-4-[(7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)methylsulfinyl]-4-phenylbutan-2-ol |
| SMILES | C[C@H](O)CC(c1ccccc1)S(=O)CC12CCC(CC1)C2(C)C |
| InChI | InChI=1S/C20H30O2S/c1-15(21)13-18(16-7-5-4-6-8-16)23(22)14-20-11-9-17(10-12-20)19(20,2)3/h4-8,15,17-18,21H,9-14H2,1-3H3/t15-,17?,18?,20?,23?/m0/s1 |
| InChIKey | GCEOGSWYQZMKSD-DBBQDZONSA-N |
| XLogP | 4.46 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.52 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-4-[(7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)methylsulfinyl]-4-phenylbutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-4-[(7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)methylsulfinyl]-4-phenylbutan-2-ol?
The IUPAC name of (2S)-4-[(7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)methylsulfinyl]-4-phenylbutan-2-ol (CID 139705703) is (2S)-4-[(7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)methylsulfinyl]-4-phenylbutan-2-ol.
What is the SMILES notation for (2S)-4-[(7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)methylsulfinyl]-4-phenylbutan-2-ol?
The canonical SMILES for (2S)-4-[(7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)methylsulfinyl]-4-phenylbutan-2-ol is C[C@H](O)CC(c1ccccc1)S(=O)CC12CCC(CC1)C2(C)C.
What is the InChIKey of (2S)-4-[(7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)methylsulfinyl]-4-phenylbutan-2-ol?
The InChIKey is GCEOGSWYQZMKSD-DBBQDZONSA-N. The full InChI is InChI=1S/C20H30O2S/c1-15(21)13-18(16-7-5-4-6-8-16)23(22)14-20-11-9-17(10-12-20)19(20,2)3/h4-8,15,17-18,21H,9-14H2,1-3H3/t15-,17?,18?,20?,23?/m0/s1.
What are the key properties of (2S)-4-[(7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)methylsulfinyl]-4-phenylbutan-2-ol?
(2S)-4-[(7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)methylsulfinyl]-4-phenylbutan-2-ol has a molecular weight of 334.52 g/mol, XLogP of 4.46, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4-[(7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)methylsulfinyl]-4-phenylbutan-2-ol is sourced from PubChem (CID 139705703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).