C28H24O4 — CID 139707056
methyl 2-[3-[(3,5-diphenylphenyl)methoxy]phenoxy]acetate (PubChem CID 139707056) has the molecular formula C28H24O4 and a molecular weight of 424.50 g/mol. Its IUPAC name is methyl 2-[3-[(3,5-diphenylphenyl)methoxy]phenoxy]acetate.
| Compound Name | methyl 2-[3-[(3,5-diphenylphenyl)methoxy]phenoxy]acetate |
|---|---|
| PubChem CID | 139707056 |
| Molecular Formula | C28H24O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | methyl 2-[3-[(3,5-diphenylphenyl)methoxy]phenoxy]acetate |
| SMILES | COC(=O)COc1cccc(OCc2cc(-c3ccccc3)cc(-c3ccccc3)c2)c1 |
| InChI | InChI=1S/C28H24O4/c1-30-28(29)20-32-27-14-8-13-26(18-27)31-19-21-15-24(22-9-4-2-5-10-22)17-25(16-21)23-11-6-3-7-12-23/h2-18H,19-20H2,1H3 |
| InChIKey | UZYMWTVFMADBDV-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |