About 5-[1-hydroxy-1-(2-methoxyphenyl)prop-2-ynyl]-1-benzofuran-2,3-diol
5-[1-hydroxy-1-(2-methoxyphenyl)prop-2-ynyl]-1-benzofuran-2,3-diol (PubChem CID 139707387) has the molecular formula C18H14O5
and a molecular weight of 310.31 g/mol. Its IUPAC name is 5-[1-hydroxy-1-(2-methoxyphenyl)prop-2-ynyl]-1-benzofuran-2,3-diol.
Molecular Properties
| Compound Name | 5-[1-hydroxy-1-(2-methoxyphenyl)prop-2-ynyl]-1-benzofuran-2,3-diol |
| PubChem CID | 139707387 |
| Molecular Formula | C18H14O5 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 5-[1-hydroxy-1-(2-methoxyphenyl)prop-2-ynyl]-1-benzofuran-2,3-diol |
| SMILES | C#CC(O)(c1ccc2oc(O)c(O)c2c1)c1ccccc1OC |
| InChI | InChI=1S/C18H14O5/c1-3-18(21,13-6-4-5-7-15(13)22-2)11-8-9-14-12(10-11)16(19)17(20)23-14/h1,4-10,19-21H,2H3 |
| InChIKey | YXBDQYISOSHGLO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[1-hydroxy-1-(2-methoxyphenyl)prop-2-ynyl]-1-benzofuran-2,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-hydroxy-1-(2-methoxyphenyl)prop-2-ynyl]-1-benzofuran-2,3-diol?
The IUPAC name of 5-[1-hydroxy-1-(2-methoxyphenyl)prop-2-ynyl]-1-benzofuran-2,3-diol (CID 139707387) is 5-[1-hydroxy-1-(2-methoxyphenyl)prop-2-ynyl]-1-benzofuran-2,3-diol.
What is the SMILES notation for 5-[1-hydroxy-1-(2-methoxyphenyl)prop-2-ynyl]-1-benzofuran-2,3-diol?
The canonical SMILES for 5-[1-hydroxy-1-(2-methoxyphenyl)prop-2-ynyl]-1-benzofuran-2,3-diol is C#CC(O)(c1ccc2oc(O)c(O)c2c1)c1ccccc1OC.
What is the InChIKey of 5-[1-hydroxy-1-(2-methoxyphenyl)prop-2-ynyl]-1-benzofuran-2,3-diol?
The InChIKey is YXBDQYISOSHGLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14O5/c1-3-18(21,13-6-4-5-7-15(13)22-2)11-8-9-14-12(10-11)16(19)17(20)23-14/h1,4-10,19-21H,2H3.
What are the key properties of 5-[1-hydroxy-1-(2-methoxyphenyl)prop-2-ynyl]-1-benzofuran-2,3-diol?
5-[1-hydroxy-1-(2-methoxyphenyl)prop-2-ynyl]-1-benzofuran-2,3-diol has a molecular weight of 310.31 g/mol, XLogP of 2.72, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-hydroxy-1-(2-methoxyphenyl)prop-2-ynyl]-1-benzofuran-2,3-diol is sourced from PubChem (CID 139707387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).