C37H45ClN4O2 — CID 139707565
(2S)-2-[3-(4-acetamido-4-phenylpiperidin-1-yl)propylamino]-N-benzyl-N-methyl-3-naphthalen-2-ylpropanamide;hydrochloride (PubChem CID 139707565) has the molecular formula C37H45ClN4O2 and a molecular weight of 613.25 g/mol. Its IUPAC name is (2S)-2-[3-(4-acetamido-4-phenylpiperidin-1-yl)propylamino]-N-benzyl-N-methyl-3-naphthalen-2-ylpropanamide;hydrochloride.
| Compound Name | (2S)-2-[3-(4-acetamido-4-phenylpiperidin-1-yl)propylamino]-N-benzyl-N-methyl-3-naphthalen-2-ylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 139707565 |
| Molecular Formula | C37H45ClN4O2 |
| Molecular Weight | 613.25 g/mol |
| Exact Mass | 612.32 |
| IUPAC Name | (2S)-2-[3-(4-acetamido-4-phenylpiperidin-1-yl)propylamino]-N-benzyl-N-methyl-3-naphthalen-2-ylpropanamide;hydrochloride |
| SMILES | CC(=O)NC1(c2ccccc2)CCN(CCCN[C@@H](Cc2ccc3ccccc3c2)C(=O)N(C)Cc2ccccc2)CC1.Cl |
| InChI | InChI=1S/C37H44N4O2.ClH/c1-29(42)39-37(34-16-7-4-8-17-34)20-24-41(25-21-37)23-11-22-38-35(36(43)40(2)28-30-12-5-3-6-13-30)27-31-18-19-32-14-9-10-15-33(32)26-31;/h3-10,12-19,26,35,38H,11,20-25,27-28H2,1-2H3,(H,39,42);1H/t35-;/m0./s1 |
| InChIKey | LIRVFGPLKBBVES-XLQCLRHOSA-N |
| XLogP | 5.94 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.25 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|