C13H27NO4Si — CID 139708119
tert-butyl 2-(hydroxymethyl)-4-trimethylsilyloxypyrrolidine-1-carboxylate (PubChem CID 139708119) has the molecular formula C13H27NO4Si and a molecular weight of 289.45 g/mol. Its IUPAC name is tert-butyl 2-(hydroxymethyl)-4-trimethylsilyloxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-(hydroxymethyl)-4-trimethylsilyloxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 139708119 |
| Molecular Formula | C13H27NO4Si |
| Molecular Weight | 289.45 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | tert-butyl 2-(hydroxymethyl)-4-trimethylsilyloxypyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(O[Si](C)(C)C)CC1CO |
| InChI | InChI=1S/C13H27NO4Si/c1-13(2,3)17-12(16)14-8-11(7-10(14)9-15)18-19(4,5)6/h10-11,15H,7-9H2,1-6H3 |
| InChIKey | QDWZEWVUBSQVOL-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.45 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|