About 3-chloro-4-[[3-(4-chlorophenyl)-3-oxoprop-1-enyl]amino]-1,1-difluorobut-3-en-2-one
3-chloro-4-[[3-(4-chlorophenyl)-3-oxoprop-1-enyl]amino]-1,1-difluorobut-3-en-2-one (PubChem CID 139708190) has the molecular formula C13H9Cl2F2NO2
and a molecular weight of 320.12 g/mol. Its IUPAC name is 3-chloro-4-[[3-(4-chlorophenyl)-3-oxoprop-1-enyl]amino]-1,1-difluorobut-3-en-2-one.
Molecular Properties
| Compound Name | 3-chloro-4-[[3-(4-chlorophenyl)-3-oxoprop-1-enyl]amino]-1,1-difluorobut-3-en-2-one |
| PubChem CID | 139708190 |
| Molecular Formula | C13H9Cl2F2NO2 |
| Molecular Weight | 320.12 g/mol |
| Exact Mass | 319.00 |
| IUPAC Name | 3-chloro-4-[[3-(4-chlorophenyl)-3-oxoprop-1-enyl]amino]-1,1-difluorobut-3-en-2-one |
| SMILES | O=C(C=CNC=C(Cl)C(=O)C(F)F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H9Cl2F2NO2/c14-9-3-1-8(2-4-9)11(19)5-6-18-7-10(15)12(20)13(16)17/h1-7,13,18H |
| InChIKey | WRYLIDWVHVFZOE-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.12 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-4-[[3-(4-chlorophenyl)-3-oxoprop-1-enyl]amino]-1,1-difluorobut-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4-[[3-(4-chlorophenyl)-3-oxoprop-1-enyl]amino]-1,1-difluorobut-3-en-2-one?
The IUPAC name of 3-chloro-4-[[3-(4-chlorophenyl)-3-oxoprop-1-enyl]amino]-1,1-difluorobut-3-en-2-one (CID 139708190) is 3-chloro-4-[[3-(4-chlorophenyl)-3-oxoprop-1-enyl]amino]-1,1-difluorobut-3-en-2-one.
What is the SMILES notation for 3-chloro-4-[[3-(4-chlorophenyl)-3-oxoprop-1-enyl]amino]-1,1-difluorobut-3-en-2-one?
The canonical SMILES for 3-chloro-4-[[3-(4-chlorophenyl)-3-oxoprop-1-enyl]amino]-1,1-difluorobut-3-en-2-one is O=C(C=CNC=C(Cl)C(=O)C(F)F)c1ccc(Cl)cc1.
What is the InChIKey of 3-chloro-4-[[3-(4-chlorophenyl)-3-oxoprop-1-enyl]amino]-1,1-difluorobut-3-en-2-one?
The InChIKey is WRYLIDWVHVFZOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9Cl2F2NO2/c14-9-3-1-8(2-4-9)11(19)5-6-18-7-10(15)12(20)13(16)17/h1-7,13,18H.
What are the key properties of 3-chloro-4-[[3-(4-chlorophenyl)-3-oxoprop-1-enyl]amino]-1,1-difluorobut-3-en-2-one?
3-chloro-4-[[3-(4-chlorophenyl)-3-oxoprop-1-enyl]amino]-1,1-difluorobut-3-en-2-one has a molecular weight of 320.12 g/mol, XLogP of 3.54, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-[[3-(4-chlorophenyl)-3-oxoprop-1-enyl]amino]-1,1-difluorobut-3-en-2-one is sourced from PubChem (CID 139708190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).