C15H14F2N6O5S2 — CID 139708217
(6R,7R)-7-[[(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-methoxyiminoacetyl]amino]-3-[(E)-3,3-difluoroprop-1-enyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 139708217) has the molecular formula C15H14F2N6O5S2 and a molecular weight of 460.44 g/mol. Its IUPAC name is (6R,7R)-7-[[(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-methoxyiminoacetyl]amino]-3-[(E)-3,3-difluoroprop-1-enyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7R)-7-[[(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-methoxyiminoacetyl]amino]-3-[(E)-3,3-difluoroprop-1-enyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 139708217 |
| Molecular Formula | C15H14F2N6O5S2 |
| Molecular Weight | 460.44 g/mol |
| Exact Mass | 460.04 |
| IUPAC Name | (6R,7R)-7-[[(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-methoxyiminoacetyl]amino]-3-[(E)-3,3-difluoroprop-1-enyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CO/N=C(\C(=O)N[C@@H]1C(=O)N2C(C(=O)O)=C(/C=C/C(F)F)CS[C@H]12)c1nsc(N)n1 |
| InChI | InChI=1S/C15H14F2N6O5S2/c1-28-21-7(10-20-15(18)30-22-10)11(24)19-8-12(25)23-9(14(26)27)5(2-3-6(16)17)4-29-13(8)23/h2-3,6,8,13H,4H2,1H3,(H,19,24)(H,26,27)(H2,18,20,22)/b3-2+,21-7-/t8-,13-/m1/s1 |
| InChIKey | KGYPEGQSPXWKES-WNBJYNPKSA-N |
| XLogP | 0.03 |
| TPSA | 160.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.44 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|