C16H18Cl2O6 — CID 139708572
bis(2-methylpropyl) 2,5-dichloro-3,6-dioxocyclohexa-1,4-diene-1,4-dicarboxylate (PubChem CID 139708572) has the molecular formula C16H18Cl2O6 and a molecular weight of 377.22 g/mol. Its IUPAC name is bis(2-methylpropyl) 2,5-dichloro-3,6-dioxocyclohexa-1,4-diene-1,4-dicarboxylate.
| Compound Name | bis(2-methylpropyl) 2,5-dichloro-3,6-dioxocyclohexa-1,4-diene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 139708572 |
| Molecular Formula | C16H18Cl2O6 |
| Molecular Weight | 377.22 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | bis(2-methylpropyl) 2,5-dichloro-3,6-dioxocyclohexa-1,4-diene-1,4-dicarboxylate |
| SMILES | CC(C)COC(=O)C1=C(Cl)C(=O)C(C(=O)OCC(C)C)=C(Cl)C1=O |
| InChI | InChI=1S/C16H18Cl2O6/c1-7(2)5-23-15(21)9-11(17)14(20)10(12(18)13(9)19)16(22)24-6-8(3)4/h7-8H,5-6H2,1-4H3 |
| InChIKey | UVCUAKAUHLVQCK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.22 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|