C21H21N3O6S — CID 139709095
2-[3-[(3-methoxy-5-methylpyrazin-2-yl)sulfamoyl]-4-phenylphenoxy]propanoic acid (PubChem CID 139709095) has the molecular formula C21H21N3O6S and a molecular weight of 443.48 g/mol. Its IUPAC name is 2-[3-[(3-methoxy-5-methylpyrazin-2-yl)sulfamoyl]-4-phenylphenoxy]propanoic acid.
| Compound Name | 2-[3-[(3-methoxy-5-methylpyrazin-2-yl)sulfamoyl]-4-phenylphenoxy]propanoic acid |
|---|---|
| PubChem CID | 139709095 |
| Molecular Formula | C21H21N3O6S |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | 2-[3-[(3-methoxy-5-methylpyrazin-2-yl)sulfamoyl]-4-phenylphenoxy]propanoic acid |
| SMILES | COc1nc(C)cnc1NS(=O)(=O)c1cc(OC(C)C(=O)O)ccc1-c1ccccc1 |
| InChI | InChI=1S/C21H21N3O6S/c1-13-12-22-19(20(23-13)29-3)24-31(27,28)18-11-16(30-14(2)21(25)26)9-10-17(18)15-7-5-4-6-8-15/h4-12,14H,1-3H3,(H,22,24)(H,25,26) |
| InChIKey | CTAPIJCETJACMS-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 127.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |