About tert-butyl (2R)-2-bromoundecanoate
tert-butyl (2R)-2-bromoundecanoate (PubChem CID 139709166) has the molecular formula C15H29BrO2
and a molecular weight of 321.30 g/mol. Its IUPAC name is tert-butyl (2R)-2-bromoundecanoate.
Molecular Properties
| Compound Name | tert-butyl (2R)-2-bromoundecanoate |
| PubChem CID | 139709166 |
| Molecular Formula | C15H29BrO2 |
| Molecular Weight | 321.30 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | tert-butyl (2R)-2-bromoundecanoate |
| SMILES | CCCCCCCCC[C@@H](Br)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H29BrO2/c1-5-6-7-8-9-10-11-12-13(16)14(17)18-15(2,3)4/h13H,5-12H2,1-4H3/t13-/m1/s1 |
| InChIKey | QDMAOVCTUWGNRA-CYBMUJFWSA-N |
| XLogP | 5.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 321.30 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (2R)-2-bromoundecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2R)-2-bromoundecanoate?
The IUPAC name of tert-butyl (2R)-2-bromoundecanoate (CID 139709166) is tert-butyl (2R)-2-bromoundecanoate.
What is the SMILES notation for tert-butyl (2R)-2-bromoundecanoate?
The canonical SMILES for tert-butyl (2R)-2-bromoundecanoate is CCCCCCCCC[C@@H](Br)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl (2R)-2-bromoundecanoate?
The InChIKey is QDMAOVCTUWGNRA-CYBMUJFWSA-N. The full InChI is InChI=1S/C15H29BrO2/c1-5-6-7-8-9-10-11-12-13(16)14(17)18-15(2,3)4/h13H,5-12H2,1-4H3/t13-/m1/s1.
What are the key properties of tert-butyl (2R)-2-bromoundecanoate?
tert-butyl (2R)-2-bromoundecanoate has a molecular weight of 321.30 g/mol, XLogP of 5.23, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2R)-2-bromoundecanoate is sourced from PubChem (CID 139709166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).