C40H36N2O4S — CID 139709212
5-[[4-[(4,7-dimethyl-2,3-dihydro-1,4-benzoxazin-2-yl)methoxy]phenyl]methyl]-3-trityl-1,3-thiazolidine-2,4-dione (PubChem CID 139709212) has the molecular formula C40H36N2O4S and a molecular weight of 640.81 g/mol. Its IUPAC name is 5-[[4-[(4,7-dimethyl-2,3-dihydro-1,4-benzoxazin-2-yl)methoxy]phenyl]methyl]-3-trityl-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[(4,7-dimethyl-2,3-dihydro-1,4-benzoxazin-2-yl)methoxy]phenyl]methyl]-3-trityl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 139709212 |
| Molecular Formula | C40H36N2O4S |
| Molecular Weight | 640.81 g/mol |
| Exact Mass | 640.24 |
| IUPAC Name | 5-[[4-[(4,7-dimethyl-2,3-dihydro-1,4-benzoxazin-2-yl)methoxy]phenyl]methyl]-3-trityl-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1ccc2c(c1)OC(COc1ccc(CC3SC(=O)N(C(c4ccccc4)(c4ccccc4)c4ccccc4)C3=O)cc1)CN2C |
| InChI | InChI=1S/C40H36N2O4S/c1-28-18-23-35-36(24-28)46-34(26-41(35)2)27-45-33-21-19-29(20-22-33)25-37-38(43)42(39(44)47-37)40(30-12-6-3-7-13-30,31-14-8-4-9-15-31)32-16-10-5-11-17-32/h3-24,34,37H,25-27H2,1-2H3 |
| InChIKey | DWAVYKIRYWTQCO-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.81 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|