C17H34O4S — CID 139709408
2-(3-dodecoxy-2-hydroxypropyl)sulfanylacetic acid (PubChem CID 139709408) has the molecular formula C17H34O4S and a molecular weight of 334.52 g/mol. Its IUPAC name is 2-(3-dodecoxy-2-hydroxypropyl)sulfanylacetic acid.
| Compound Name | 2-(3-dodecoxy-2-hydroxypropyl)sulfanylacetic acid |
|---|---|
| PubChem CID | 139709408 |
| Molecular Formula | C17H34O4S |
| Molecular Weight | 334.52 g/mol |
| Exact Mass | 334.22 |
| IUPAC Name | 2-(3-dodecoxy-2-hydroxypropyl)sulfanylacetic acid |
| SMILES | CCCCCCCCCCCCOCC(O)CSCC(=O)O |
| InChI | InChI=1S/C17H34O4S/c1-2-3-4-5-6-7-8-9-10-11-12-21-13-16(18)14-22-15-17(19)20/h16,18H,2-15H2,1H3,(H,19,20) |
| InChIKey | OWUILQYUKXKTOR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.52 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|