C17H22N2O — CID 139710200
[5-methyl-1-(2-phenylpropan-2-yl)cyclohexa-2,4-dien-1-yl]urea (PubChem CID 139710200) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is [5-methyl-1-(2-phenylpropan-2-yl)cyclohexa-2,4-dien-1-yl]urea.
| Compound Name | [5-methyl-1-(2-phenylpropan-2-yl)cyclohexa-2,4-dien-1-yl]urea |
|---|---|
| PubChem CID | 139710200 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | [5-methyl-1-(2-phenylpropan-2-yl)cyclohexa-2,4-dien-1-yl]urea |
| SMILES | CC1=CC=CC(NC(N)=O)(C(C)(C)c2ccccc2)C1 |
| InChI | InChI=1S/C17H22N2O/c1-13-8-7-11-17(12-13,19-15(18)20)16(2,3)14-9-5-4-6-10-14/h4-11H,12H2,1-3H3,(H3,18,19,20) |
| InChIKey | WLKOPSHTYXJZML-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |