C29H46N2O2 — CID 139710494
(1R,2S)-1-[4-(5-decylpyrimidin-2-yl)phenyl]nonane-1,2-diol (PubChem CID 139710494) has the molecular formula C29H46N2O2 and a molecular weight of 454.70 g/mol. Its IUPAC name is (1R,2S)-1-[4-(5-decylpyrimidin-2-yl)phenyl]nonane-1,2-diol.
| Compound Name | (1R,2S)-1-[4-(5-decylpyrimidin-2-yl)phenyl]nonane-1,2-diol |
|---|---|
| PubChem CID | 139710494 |
| Molecular Formula | C29H46N2O2 |
| Molecular Weight | 454.70 g/mol |
| Exact Mass | 454.36 |
| IUPAC Name | (1R,2S)-1-[4-(5-decylpyrimidin-2-yl)phenyl]nonane-1,2-diol |
| SMILES | CCCCCCCCCCc1cnc(-c2ccc([C@@H](O)[C@@H](O)CCCCCCC)cc2)nc1 |
| InChI | InChI=1S/C29H46N2O2/c1-3-5-7-9-10-11-13-14-16-24-22-30-29(31-23-24)26-20-18-25(19-21-26)28(33)27(32)17-15-12-8-6-4-2/h18-23,27-28,32-33H,3-17H2,1-2H3/t27-,28+/m0/s1 |
| InChIKey | IZKLOKBWFVDLSQ-WUFINQPMSA-N |
| XLogP | 7.58 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.70 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|