About (1S)-1-[2,4-bis(trifluoromethyl)phenyl]-3-(4-phenylpiperidin-4-yl)propan-1-ol
(1S)-1-[2,4-bis(trifluoromethyl)phenyl]-3-(4-phenylpiperidin-4-yl)propan-1-ol (PubChem CID 139710550) has the molecular formula C22H23F6NO
and a molecular weight of 431.42 g/mol. Its IUPAC name is (1S)-1-[2,4-bis(trifluoromethyl)phenyl]-3-(4-phenylpiperidin-4-yl)propan-1-ol.
Molecular Properties
| Compound Name | (1S)-1-[2,4-bis(trifluoromethyl)phenyl]-3-(4-phenylpiperidin-4-yl)propan-1-ol |
| PubChem CID | 139710550 |
| Molecular Formula | C22H23F6NO |
| Molecular Weight | 431.42 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | (1S)-1-[2,4-bis(trifluoromethyl)phenyl]-3-(4-phenylpiperidin-4-yl)propan-1-ol |
| SMILES | O[C@@H](CCC1(c2ccccc2)CCNCC1)c1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C22H23F6NO/c23-21(24,25)16-6-7-17(18(14-16)22(26,27)28)19(30)8-9-20(10-12-29-13-11-20)15-4-2-1-3-5-15/h1-7,14,19,29-30H,8-13H2/t19-/m0/s1 |
| InChIKey | PHDHTQIVTZQQOG-IBGZPJMESA-N |
| XLogP | 5.86 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 431.42 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S)-1-[2,4-bis(trifluoromethyl)phenyl]-3-(4-phenylpiperidin-4-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-[2,4-bis(trifluoromethyl)phenyl]-3-(4-phenylpiperidin-4-yl)propan-1-ol?
The IUPAC name of (1S)-1-[2,4-bis(trifluoromethyl)phenyl]-3-(4-phenylpiperidin-4-yl)propan-1-ol (CID 139710550) is (1S)-1-[2,4-bis(trifluoromethyl)phenyl]-3-(4-phenylpiperidin-4-yl)propan-1-ol.
What is the SMILES notation for (1S)-1-[2,4-bis(trifluoromethyl)phenyl]-3-(4-phenylpiperidin-4-yl)propan-1-ol?
The canonical SMILES for (1S)-1-[2,4-bis(trifluoromethyl)phenyl]-3-(4-phenylpiperidin-4-yl)propan-1-ol is O[C@@H](CCC1(c2ccccc2)CCNCC1)c1ccc(C(F)(F)F)cc1C(F)(F)F.
What is the InChIKey of (1S)-1-[2,4-bis(trifluoromethyl)phenyl]-3-(4-phenylpiperidin-4-yl)propan-1-ol?
The InChIKey is PHDHTQIVTZQQOG-IBGZPJMESA-N. The full InChI is InChI=1S/C22H23F6NO/c23-21(24,25)16-6-7-17(18(14-16)22(26,27)28)19(30)8-9-20(10-12-29-13-11-20)15-4-2-1-3-5-15/h1-7,14,19,29-30H,8-13H2/t19-/m0/s1.
What are the key properties of (1S)-1-[2,4-bis(trifluoromethyl)phenyl]-3-(4-phenylpiperidin-4-yl)propan-1-ol?
(1S)-1-[2,4-bis(trifluoromethyl)phenyl]-3-(4-phenylpiperidin-4-yl)propan-1-ol has a molecular weight of 431.42 g/mol, XLogP of 5.86, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-[2,4-bis(trifluoromethyl)phenyl]-3-(4-phenylpiperidin-4-yl)propan-1-ol is sourced from PubChem (CID 139710550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).