C50H50O4S — CID 139711832
[6-[6-(1,1,2,3,3-pentamethyl-2H-indene-5-carbonyl)naphthalen-2-yl]sulfonylnaphthalen-2-yl]-(1,1,2,3,3-pentamethyl-2H-inden-5-yl)methanone (PubChem CID 139711832) has the molecular formula C50H50O4S and a molecular weight of 747.01 g/mol. Its IUPAC name is [6-[6-(1,1,2,3,3-pentamethyl-2H-indene-5-carbonyl)naphthalen-2-yl]sulfonylnaphthalen-2-yl]-(1,1,2,3,3-pentamethyl-2H-inden-5-yl)methanone.
| Compound Name | [6-[6-(1,1,2,3,3-pentamethyl-2H-indene-5-carbonyl)naphthalen-2-yl]sulfonylnaphthalen-2-yl]-(1,1,2,3,3-pentamethyl-2H-inden-5-yl)methanone |
|---|---|
| PubChem CID | 139711832 |
| Molecular Formula | C50H50O4S |
| Molecular Weight | 747.01 g/mol |
| Exact Mass | 746.34 |
| IUPAC Name | [6-[6-(1,1,2,3,3-pentamethyl-2H-indene-5-carbonyl)naphthalen-2-yl]sulfonylnaphthalen-2-yl]-(1,1,2,3,3-pentamethyl-2H-inden-5-yl)methanone |
| SMILES | CC1C(C)(C)c2ccc(C(=O)c3ccc4cc(S(=O)(=O)c5ccc6cc(C(=O)c7ccc8c(c7)C(C)(C)C(C)C8(C)C)ccc6c5)ccc4c3)cc2C1(C)C |
| InChI | InChI=1S/C50H50O4S/c1-29-47(3,4)41-21-17-37(27-43(41)49(29,7)8)45(51)35-13-11-33-25-39(19-15-31(33)23-35)55(53,54)40-20-16-32-24-36(14-12-34(32)26-40)46(52)38-18-22-42-44(28-38)50(9,10)30(2)48(42,5)6/h11-30H,1-10H3 |
| InChIKey | OZSZZWVUZPKMDW-UHFFFAOYSA-N |
| XLogP | 11.70 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.01 |
| LogP ≤ 5 | 11.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |