About 1,4-dimethoxycyclohexa-2,4-diene-1-sulfonamide
1,4-dimethoxycyclohexa-2,4-diene-1-sulfonamide (PubChem CID 139712463) has the molecular formula C8H13NO4S
and a molecular weight of 219.26 g/mol. Its IUPAC name is 1,4-dimethoxycyclohexa-2,4-diene-1-sulfonamide.
Molecular Properties
| Compound Name | 1,4-dimethoxycyclohexa-2,4-diene-1-sulfonamide |
| PubChem CID | 139712463 |
| Molecular Formula | C8H13NO4S |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | 1,4-dimethoxycyclohexa-2,4-diene-1-sulfonamide |
| SMILES | COC1=CCC(OC)(S(N)(=O)=O)C=C1 |
| InChI | InChI=1S/C8H13NO4S/c1-12-7-3-5-8(13-2,6-4-7)14(9,10)11/h3-5H,6H2,1-2H3,(H2,9,10,11) |
| InChIKey | IMZVBMHMVLRBTB-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,4-dimethoxycyclohexa-2,4-diene-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethoxycyclohexa-2,4-diene-1-sulfonamide?
The IUPAC name of 1,4-dimethoxycyclohexa-2,4-diene-1-sulfonamide (CID 139712463) is 1,4-dimethoxycyclohexa-2,4-diene-1-sulfonamide.
What is the SMILES notation for 1,4-dimethoxycyclohexa-2,4-diene-1-sulfonamide?
The canonical SMILES for 1,4-dimethoxycyclohexa-2,4-diene-1-sulfonamide is COC1=CCC(OC)(S(N)(=O)=O)C=C1.
What is the InChIKey of 1,4-dimethoxycyclohexa-2,4-diene-1-sulfonamide?
The InChIKey is IMZVBMHMVLRBTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO4S/c1-12-7-3-5-8(13-2,6-4-7)14(9,10)11/h3-5H,6H2,1-2H3,(H2,9,10,11).
What are the key properties of 1,4-dimethoxycyclohexa-2,4-diene-1-sulfonamide?
1,4-dimethoxycyclohexa-2,4-diene-1-sulfonamide has a molecular weight of 219.26 g/mol, XLogP of 0.11, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethoxycyclohexa-2,4-diene-1-sulfonamide is sourced from PubChem (CID 139712463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).