About 1-methyl-2,4-dihydrotriazine-3,5-diamine
1-methyl-2,4-dihydrotriazine-3,5-diamine (PubChem CID 139712983) has the molecular formula C4H11N5
and a molecular weight of 129.17 g/mol. Its IUPAC name is 1-methyl-2,4-dihydrotriazine-3,5-diamine.
Molecular Properties
| Compound Name | 1-methyl-2,4-dihydrotriazine-3,5-diamine |
| PubChem CID | 139712983 |
| Molecular Formula | C4H11N5 |
| Molecular Weight | 129.17 g/mol |
| Exact Mass | 129.10 |
| IUPAC Name | 1-methyl-2,4-dihydrotriazine-3,5-diamine |
| SMILES | CN1C=C(N)CN(N)N1 |
| InChI | InChI=1S/C4H11N5/c1-8-2-4(5)3-9(6)7-8/h2,7H,3,5-6H2,1H3 |
| InChIKey | YQDYVZCEZSHMTG-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 70.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.17 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2,4-dihydrotriazine-3,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2,4-dihydrotriazine-3,5-diamine?
The IUPAC name of 1-methyl-2,4-dihydrotriazine-3,5-diamine (CID 139712983) is 1-methyl-2,4-dihydrotriazine-3,5-diamine.
What is the SMILES notation for 1-methyl-2,4-dihydrotriazine-3,5-diamine?
The canonical SMILES for 1-methyl-2,4-dihydrotriazine-3,5-diamine is CN1C=C(N)CN(N)N1.
What is the InChIKey of 1-methyl-2,4-dihydrotriazine-3,5-diamine?
The InChIKey is YQDYVZCEZSHMTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11N5/c1-8-2-4(5)3-9(6)7-8/h2,7H,3,5-6H2,1H3.
What are the key properties of 1-methyl-2,4-dihydrotriazine-3,5-diamine?
1-methyl-2,4-dihydrotriazine-3,5-diamine has a molecular weight of 129.17 g/mol, XLogP of -1.67, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2,4-dihydrotriazine-3,5-diamine is sourced from PubChem (CID 139712983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).