C23H22ClN3O6S — CID 139713706
2-[3-[(4-chlorophenyl)carbamoyl]-N-methyl-2-nitroanilino]ethyl 4-methylbenzenesulfonate (PubChem CID 139713706) has the molecular formula C23H22ClN3O6S and a molecular weight of 503.96 g/mol. Its IUPAC name is 2-[3-[(4-chlorophenyl)carbamoyl]-N-methyl-2-nitroanilino]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[3-[(4-chlorophenyl)carbamoyl]-N-methyl-2-nitroanilino]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 139713706 |
| Molecular Formula | C23H22ClN3O6S |
| Molecular Weight | 503.96 g/mol |
| Exact Mass | 503.09 |
| IUPAC Name | 2-[3-[(4-chlorophenyl)carbamoyl]-N-methyl-2-nitroanilino]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCN(C)c2cccc(C(=O)Nc3ccc(Cl)cc3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H22ClN3O6S/c1-16-6-12-19(13-7-16)34(31,32)33-15-14-26(2)21-5-3-4-20(22(21)27(29)30)23(28)25-18-10-8-17(24)9-11-18/h3-13H,14-15H2,1-2H3,(H,25,28) |
| InChIKey | OTDBGYFLFMAZMN-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.96 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|