C15H21F3N4O2 — CID 139713734
2-acetamido-3-[2-(dimethylamino)ethyl-methylamino]-N-(trifluoromethyl)benzamide (PubChem CID 139713734) has the molecular formula C15H21F3N4O2 and a molecular weight of 346.35 g/mol. Its IUPAC name is 2-acetamido-3-[2-(dimethylamino)ethyl-methylamino]-N-(trifluoromethyl)benzamide.
| Compound Name | 2-acetamido-3-[2-(dimethylamino)ethyl-methylamino]-N-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 139713734 |
| Molecular Formula | C15H21F3N4O2 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 2-acetamido-3-[2-(dimethylamino)ethyl-methylamino]-N-(trifluoromethyl)benzamide |
| SMILES | CC(=O)Nc1c(C(=O)NC(F)(F)F)cccc1N(C)CCN(C)C |
| InChI | InChI=1S/C15H21F3N4O2/c1-10(23)19-13-11(14(24)20-15(16,17)18)6-5-7-12(13)22(4)9-8-21(2)3/h5-7H,8-9H2,1-4H3,(H,19,23)(H,20,24) |
| InChIKey | FNONSYHCYNAAJY-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|