C16H8F4N2O2 — CID 139713966
3-[3-(1,1,2,2-tetrafluoroethoxy)phenoxy]benzene-1,2-dicarbonitrile (PubChem CID 139713966) has the molecular formula C16H8F4N2O2 and a molecular weight of 336.24 g/mol. Its IUPAC name is 3-[3-(1,1,2,2-tetrafluoroethoxy)phenoxy]benzene-1,2-dicarbonitrile.
| Compound Name | 3-[3-(1,1,2,2-tetrafluoroethoxy)phenoxy]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 139713966 |
| Molecular Formula | C16H8F4N2O2 |
| Molecular Weight | 336.24 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 3-[3-(1,1,2,2-tetrafluoroethoxy)phenoxy]benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1cccc(Oc2cccc(OC(F)(F)C(F)F)c2)c1C#N |
| InChI | InChI=1S/C16H8F4N2O2/c17-15(18)16(19,20)24-12-5-2-4-11(7-12)23-14-6-1-3-10(8-21)13(14)9-22/h1-7,15H |
| InChIKey | QPPDHXFITRMPLD-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.24 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|