About O-(4-tert-butylphenyl) N-[3-(3-anilino-2-methoxypropoxy)phenyl]-N-methylcarbamothioate
O-(4-tert-butylphenyl) N-[3-(3-anilino-2-methoxypropoxy)phenyl]-N-methylcarbamothioate (PubChem CID 139714747) has the molecular formula C28H34N2O3S
and a molecular weight of 478.66 g/mol. Its IUPAC name is O-(4-tert-butylphenyl) N-[3-(3-anilino-2-methoxypropoxy)phenyl]-N-methylcarbamothioate.
Molecular Properties
| Compound Name | O-(4-tert-butylphenyl) N-[3-(3-anilino-2-methoxypropoxy)phenyl]-N-methylcarbamothioate |
| PubChem CID | 139714747 |
| Molecular Formula | C28H34N2O3S |
| Molecular Weight | 478.66 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | O-(4-tert-butylphenyl) N-[3-(3-anilino-2-methoxypropoxy)phenyl]-N-methylcarbamothioate |
| SMILES | COC(CNc1ccccc1)COc1cccc(N(C)C(=S)Oc2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C28H34N2O3S/c1-28(2,3)21-14-16-24(17-15-21)33-27(34)30(4)23-12-9-13-25(18-23)32-20-26(31-5)19-29-22-10-7-6-8-11-22/h6-18,26,29H,19-20H2,1-5H3 |
| InChIKey | JYCHXFFQRXTZEL-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 478.66 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-(4-tert-butylphenyl) N-[3-(3-anilino-2-methoxypropoxy)phenyl]-N-methylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-(4-tert-butylphenyl) N-[3-(3-anilino-2-methoxypropoxy)phenyl]-N-methylcarbamothioate?
The IUPAC name of O-(4-tert-butylphenyl) N-[3-(3-anilino-2-methoxypropoxy)phenyl]-N-methylcarbamothioate (CID 139714747) is O-(4-tert-butylphenyl) N-[3-(3-anilino-2-methoxypropoxy)phenyl]-N-methylcarbamothioate.
What is the SMILES notation for O-(4-tert-butylphenyl) N-[3-(3-anilino-2-methoxypropoxy)phenyl]-N-methylcarbamothioate?
The canonical SMILES for O-(4-tert-butylphenyl) N-[3-(3-anilino-2-methoxypropoxy)phenyl]-N-methylcarbamothioate is COC(CNc1ccccc1)COc1cccc(N(C)C(=S)Oc2ccc(C(C)(C)C)cc2)c1.
What is the InChIKey of O-(4-tert-butylphenyl) N-[3-(3-anilino-2-methoxypropoxy)phenyl]-N-methylcarbamothioate?
The InChIKey is JYCHXFFQRXTZEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H34N2O3S/c1-28(2,3)21-14-16-24(17-15-21)33-27(34)30(4)23-12-9-13-25(18-23)32-20-26(31-5)19-29-22-10-7-6-8-11-22/h6-18,26,29H,19-20H2,1-5H3.
What are the key properties of O-(4-tert-butylphenyl) N-[3-(3-anilino-2-methoxypropoxy)phenyl]-N-methylcarbamothioate?
O-(4-tert-butylphenyl) N-[3-(3-anilino-2-methoxypropoxy)phenyl]-N-methylcarbamothioate has a molecular weight of 478.66 g/mol, XLogP of 6.29, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for O-(4-tert-butylphenyl) N-[3-(3-anilino-2-methoxypropoxy)phenyl]-N-methylcarbamothioate is sourced from PubChem (CID 139714747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).