About 5-thiophen-3-yl-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole
5-thiophen-3-yl-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole (PubChem CID 139714948) has the molecular formula C10H10N2S
and a molecular weight of 190.27 g/mol. Its IUPAC name is 5-thiophen-3-yl-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole.
Molecular Properties
| Compound Name | 5-thiophen-3-yl-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole |
| PubChem CID | 139714948 |
| Molecular Formula | C10H10N2S |
| Molecular Weight | 190.27 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 5-thiophen-3-yl-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole |
| SMILES | c1cc(C2CCc3cncn32)cs1 |
| InChI | InChI=1S/C10H10N2S/c1-2-10(8-3-4-13-6-8)12-7-11-5-9(1)12/h3-7,10H,1-2H2 |
| InChIKey | YFPMYURNRPVDCL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.27 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-thiophen-3-yl-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-thiophen-3-yl-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole?
The IUPAC name of 5-thiophen-3-yl-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole (CID 139714948) is 5-thiophen-3-yl-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole.
What is the SMILES notation for 5-thiophen-3-yl-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole?
The canonical SMILES for 5-thiophen-3-yl-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole is c1cc(C2CCc3cncn32)cs1.
What is the InChIKey of 5-thiophen-3-yl-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole?
The InChIKey is YFPMYURNRPVDCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2S/c1-2-10(8-3-4-13-6-8)12-7-11-5-9(1)12/h3-7,10H,1-2H2.
What are the key properties of 5-thiophen-3-yl-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole?
5-thiophen-3-yl-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole has a molecular weight of 190.27 g/mol, XLogP of 2.48, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-thiophen-3-yl-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole is sourced from PubChem (CID 139714948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).