C36H46N2O2Si2 — CID 139715524
2,3-bis[1-[tert-butyl(dimethyl)silyl]indol-3-yl]-5,6-dimethylcyclohexa-2,5-diene-1,4-dione (PubChem CID 139715524) has the molecular formula C36H46N2O2Si2 and a molecular weight of 594.95 g/mol. Its IUPAC name is 2,3-bis[1-[tert-butyl(dimethyl)silyl]indol-3-yl]-5,6-dimethylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,3-bis[1-[tert-butyl(dimethyl)silyl]indol-3-yl]-5,6-dimethylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 139715524 |
| Molecular Formula | C36H46N2O2Si2 |
| Molecular Weight | 594.95 g/mol |
| Exact Mass | 594.31 |
| IUPAC Name | 2,3-bis[1-[tert-butyl(dimethyl)silyl]indol-3-yl]-5,6-dimethylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=C(C)C(=O)C(c2cn([Si](C)(C)C(C)(C)C)c3ccccc23)=C(c2cn([Si](C)(C)C(C)(C)C)c3ccccc23)C1=O |
| InChI | InChI=1S/C36H46N2O2Si2/c1-23-24(2)34(40)32(28-22-38(42(11,12)36(6,7)8)30-20-16-14-18-26(28)30)31(33(23)39)27-21-37(41(9,10)35(3,4)5)29-19-15-13-17-25(27)29/h13-22H,1-12H3 |
| InChIKey | MXTCRVCBWVCLGE-UHFFFAOYSA-N |
| XLogP | 9.70 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.95 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|