About 4-amino-1-fluoro-2,2-bis(fluoromethyl)-5-methylhexan-3-ol
4-amino-1-fluoro-2,2-bis(fluoromethyl)-5-methylhexan-3-ol (PubChem CID 139715698) has the molecular formula C9H18F3NO
and a molecular weight of 213.24 g/mol. Its IUPAC name is 4-amino-1-fluoro-2,2-bis(fluoromethyl)-5-methylhexan-3-ol.
Molecular Properties
| Compound Name | 4-amino-1-fluoro-2,2-bis(fluoromethyl)-5-methylhexan-3-ol |
| PubChem CID | 139715698 |
| Molecular Formula | C9H18F3NO |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 4-amino-1-fluoro-2,2-bis(fluoromethyl)-5-methylhexan-3-ol |
| SMILES | CC(C)C(N)C(O)C(CF)(CF)CF |
| InChI | InChI=1S/C9H18F3NO/c1-6(2)7(13)8(14)9(3-10,4-11)5-12/h6-8,14H,3-5,13H2,1-2H3 |
| InChIKey | NLELEPHKAPQQKH-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-amino-1-fluoro-2,2-bis(fluoromethyl)-5-methylhexan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1-fluoro-2,2-bis(fluoromethyl)-5-methylhexan-3-ol?
The IUPAC name of 4-amino-1-fluoro-2,2-bis(fluoromethyl)-5-methylhexan-3-ol (CID 139715698) is 4-amino-1-fluoro-2,2-bis(fluoromethyl)-5-methylhexan-3-ol.
What is the SMILES notation for 4-amino-1-fluoro-2,2-bis(fluoromethyl)-5-methylhexan-3-ol?
The canonical SMILES for 4-amino-1-fluoro-2,2-bis(fluoromethyl)-5-methylhexan-3-ol is CC(C)C(N)C(O)C(CF)(CF)CF.
What is the InChIKey of 4-amino-1-fluoro-2,2-bis(fluoromethyl)-5-methylhexan-3-ol?
The InChIKey is NLELEPHKAPQQKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18F3NO/c1-6(2)7(13)8(14)9(3-10,4-11)5-12/h6-8,14H,3-5,13H2,1-2H3.
What are the key properties of 4-amino-1-fluoro-2,2-bis(fluoromethyl)-5-methylhexan-3-ol?
4-amino-1-fluoro-2,2-bis(fluoromethyl)-5-methylhexan-3-ol has a molecular weight of 213.24 g/mol, XLogP of 1.23, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1-fluoro-2,2-bis(fluoromethyl)-5-methylhexan-3-ol is sourced from PubChem (CID 139715698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).