About O-[2-[(2,4-dibromophenyl)methylsulfanyl]ethyl] prop-2-enethioate
O-[2-[(2,4-dibromophenyl)methylsulfanyl]ethyl] prop-2-enethioate (PubChem CID 139715939) has the molecular formula C12H12Br2OS2
and a molecular weight of 396.17 g/mol. Its IUPAC name is O-[2-[(2,4-dibromophenyl)methylsulfanyl]ethyl] prop-2-enethioate.
Molecular Properties
| Compound Name | O-[2-[(2,4-dibromophenyl)methylsulfanyl]ethyl] prop-2-enethioate |
| PubChem CID | 139715939 |
| Molecular Formula | C12H12Br2OS2 |
| Molecular Weight | 396.17 g/mol |
| Exact Mass | 393.87 |
| IUPAC Name | O-[2-[(2,4-dibromophenyl)methylsulfanyl]ethyl] prop-2-enethioate |
| SMILES | C=CC(=S)OCCSCc1ccc(Br)cc1Br |
| InChI | InChI=1S/C12H12Br2OS2/c1-2-12(16)15-5-6-17-8-9-3-4-10(13)7-11(9)14/h2-4,7H,1,5-6,8H2 |
| InChIKey | PESGKEUKQGVGHR-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.17 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-[2-[(2,4-dibromophenyl)methylsulfanyl]ethyl] prop-2-enethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-[2-[(2,4-dibromophenyl)methylsulfanyl]ethyl] prop-2-enethioate?
The IUPAC name of O-[2-[(2,4-dibromophenyl)methylsulfanyl]ethyl] prop-2-enethioate (CID 139715939) is O-[2-[(2,4-dibromophenyl)methylsulfanyl]ethyl] prop-2-enethioate.
What is the SMILES notation for O-[2-[(2,4-dibromophenyl)methylsulfanyl]ethyl] prop-2-enethioate?
The canonical SMILES for O-[2-[(2,4-dibromophenyl)methylsulfanyl]ethyl] prop-2-enethioate is C=CC(=S)OCCSCc1ccc(Br)cc1Br.
What is the InChIKey of O-[2-[(2,4-dibromophenyl)methylsulfanyl]ethyl] prop-2-enethioate?
The InChIKey is PESGKEUKQGVGHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12Br2OS2/c1-2-12(16)15-5-6-17-8-9-3-4-10(13)7-11(9)14/h2-4,7H,1,5-6,8H2.
What are the key properties of O-[2-[(2,4-dibromophenyl)methylsulfanyl]ethyl] prop-2-enethioate?
O-[2-[(2,4-dibromophenyl)methylsulfanyl]ethyl] prop-2-enethioate has a molecular weight of 396.17 g/mol, XLogP of 4.97, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-[2-[(2,4-dibromophenyl)methylsulfanyl]ethyl] prop-2-enethioate is sourced from PubChem (CID 139715939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).