About phenylazanium;tetrakis(3,5-difluorophenyl)boranuide
phenylazanium;tetrakis(3,5-difluorophenyl)boranuide (PubChem CID 139716043) has the molecular formula C30H20BF8N
and a molecular weight of 557.29 g/mol. Its IUPAC name is phenylazanium;tetrakis(3,5-difluorophenyl)boranuide.
Molecular Properties
| Compound Name | phenylazanium;tetrakis(3,5-difluorophenyl)boranuide |
| PubChem CID | 139716043 |
| Molecular Formula | C30H20BF8N |
| Molecular Weight | 557.29 g/mol |
| Exact Mass | 557.16 |
| IUPAC Name | phenylazanium;tetrakis(3,5-difluorophenyl)boranuide |
| SMILES | Fc1cc(F)cc([B-](c2cc(F)cc(F)c2)(c2cc(F)cc(F)c2)c2cc(F)cc(F)c2)c1.[NH3+]c1ccccc1 |
| InChI | InChI=1S/C24H12BF8.C6H7N/c26-17-1-13(2-18(27)9-17)25(14-3-19(28)10-20(29)4-14,15-5-21(30)11-22(31)6-15)16-7-23(32)12-24(33)8-16;7-6-4-2-1-3-5-6/h1-12H;1-5H,7H2/q-1;/p+1 |
| InChIKey | VGKGSHKCSWKULK-UHFFFAOYSA-O |
| XLogP | 4.74 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 557.29 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze phenylazanium;tetrakis(3,5-difluorophenyl)boranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenylazanium;tetrakis(3,5-difluorophenyl)boranuide?
The IUPAC name of phenylazanium;tetrakis(3,5-difluorophenyl)boranuide (CID 139716043) is phenylazanium;tetrakis(3,5-difluorophenyl)boranuide.
What is the SMILES notation for phenylazanium;tetrakis(3,5-difluorophenyl)boranuide?
The canonical SMILES for phenylazanium;tetrakis(3,5-difluorophenyl)boranuide is Fc1cc(F)cc([B-](c2cc(F)cc(F)c2)(c2cc(F)cc(F)c2)c2cc(F)cc(F)c2)c1.[NH3+]c1ccccc1.
What is the InChIKey of phenylazanium;tetrakis(3,5-difluorophenyl)boranuide?
The InChIKey is VGKGSHKCSWKULK-UHFFFAOYSA-O. The full InChI is InChI=1S/C24H12BF8.C6H7N/c26-17-1-13(2-18(27)9-17)25(14-3-19(28)10-20(29)4-14,15-5-21(30)11-22(31)6-15)16-7-23(32)12-24(33)8-16;7-6-4-2-1-3-5-6/h1-12H;1-5H,7H2/q-1;/p+1.
What are the key properties of phenylazanium;tetrakis(3,5-difluorophenyl)boranuide?
phenylazanium;tetrakis(3,5-difluorophenyl)boranuide has a molecular weight of 557.29 g/mol, XLogP of 4.74, 4 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for phenylazanium;tetrakis(3,5-difluorophenyl)boranuide is sourced from PubChem (CID 139716043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).