C33H30N4O — CID 139716400
1,7-didiazo-3,5-dimethyl-1,3,5,7-tetraphenylheptan-4-one (PubChem CID 139716400) has the molecular formula C33H30N4O and a molecular weight of 498.63 g/mol. Its IUPAC name is 1,7-didiazo-3,5-dimethyl-1,3,5,7-tetraphenylheptan-4-one.
| Compound Name | 1,7-didiazo-3,5-dimethyl-1,3,5,7-tetraphenylheptan-4-one |
|---|---|
| PubChem CID | 139716400 |
| Molecular Formula | C33H30N4O |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | 1,7-didiazo-3,5-dimethyl-1,3,5,7-tetraphenylheptan-4-one |
| SMILES | CC(CC(=[N+]=[N-])c1ccccc1)(C(=O)C(C)(CC(=[N+]=[N-])c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H30N4O/c1-32(27-19-11-5-12-20-27,23-29(36-34)25-15-7-3-8-16-25)31(38)33(2,28-21-13-6-14-22-28)24-30(37-35)26-17-9-4-10-18-26/h3-22H,23-24H2,1-2H3 |
| InChIKey | SQVMSFODBZXUCD-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 89.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|