C17H21N3O4 — CID 139716553
3-oxobutyl N-[(6-cyano-2,2-dimethyl-3,4-dihydrochromen-4-yl)amino]carbamate (PubChem CID 139716553) has the molecular formula C17H21N3O4 and a molecular weight of 331.37 g/mol. Its IUPAC name is 3-oxobutyl N-[(6-cyano-2,2-dimethyl-3,4-dihydrochromen-4-yl)amino]carbamate.
| Compound Name | 3-oxobutyl N-[(6-cyano-2,2-dimethyl-3,4-dihydrochromen-4-yl)amino]carbamate |
|---|---|
| PubChem CID | 139716553 |
| Molecular Formula | C17H21N3O4 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 3-oxobutyl N-[(6-cyano-2,2-dimethyl-3,4-dihydrochromen-4-yl)amino]carbamate |
| SMILES | CC(=O)CCOC(=O)NNC1CC(C)(C)Oc2ccc(C#N)cc21 |
| InChI | InChI=1S/C17H21N3O4/c1-11(21)6-7-23-16(22)20-19-14-9-17(2,3)24-15-5-4-12(10-18)8-13(14)15/h4-5,8,14,19H,6-7,9H2,1-3H3,(H,20,22) |
| InChIKey | RKBRCONVDYHBLH-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|