About [1-[2-[2-(1,3-dioxoisoindol-2-yl)imidazol-1-yl]ethyl]pyrrolidin-3-yl] methanesulfonate
[1-[2-[2-(1,3-dioxoisoindol-2-yl)imidazol-1-yl]ethyl]pyrrolidin-3-yl] methanesulfonate (PubChem CID 139716807) has the molecular formula C18H20N4O5S
and a molecular weight of 404.45 g/mol. Its IUPAC name is [1-[2-[2-(1,3-dioxoisoindol-2-yl)imidazol-1-yl]ethyl]pyrrolidin-3-yl] methanesulfonate.
Molecular Properties
| Compound Name | [1-[2-[2-(1,3-dioxoisoindol-2-yl)imidazol-1-yl]ethyl]pyrrolidin-3-yl] methanesulfonate |
| PubChem CID | 139716807 |
| Molecular Formula | C18H20N4O5S |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | [1-[2-[2-(1,3-dioxoisoindol-2-yl)imidazol-1-yl]ethyl]pyrrolidin-3-yl] methanesulfonate |
| SMILES | CS(=O)(=O)OC1CCN(CCn2ccnc2N2C(=O)c3ccccc3C2=O)C1 |
| InChI | InChI=1S/C18H20N4O5S/c1-28(25,26)27-13-6-8-20(12-13)10-11-21-9-7-19-18(21)22-16(23)14-4-2-3-5-15(14)17(22)24/h2-5,7,9,13H,6,8,10-12H2,1H3 |
| InChIKey | IECDAEBBCWJXCA-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 101.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [1-[2-[2-(1,3-dioxoisoindol-2-yl)imidazol-1-yl]ethyl]pyrrolidin-3-yl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[2-[2-(1,3-dioxoisoindol-2-yl)imidazol-1-yl]ethyl]pyrrolidin-3-yl] methanesulfonate?
The IUPAC name of [1-[2-[2-(1,3-dioxoisoindol-2-yl)imidazol-1-yl]ethyl]pyrrolidin-3-yl] methanesulfonate (CID 139716807) is [1-[2-[2-(1,3-dioxoisoindol-2-yl)imidazol-1-yl]ethyl]pyrrolidin-3-yl] methanesulfonate.
What is the SMILES notation for [1-[2-[2-(1,3-dioxoisoindol-2-yl)imidazol-1-yl]ethyl]pyrrolidin-3-yl] methanesulfonate?
The canonical SMILES for [1-[2-[2-(1,3-dioxoisoindol-2-yl)imidazol-1-yl]ethyl]pyrrolidin-3-yl] methanesulfonate is CS(=O)(=O)OC1CCN(CCn2ccnc2N2C(=O)c3ccccc3C2=O)C1.
What is the InChIKey of [1-[2-[2-(1,3-dioxoisoindol-2-yl)imidazol-1-yl]ethyl]pyrrolidin-3-yl] methanesulfonate?
The InChIKey is IECDAEBBCWJXCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N4O5S/c1-28(25,26)27-13-6-8-20(12-13)10-11-21-9-7-19-18(21)22-16(23)14-4-2-3-5-15(14)17(22)24/h2-5,7,9,13H,6,8,10-12H2,1H3.
What are the key properties of [1-[2-[2-(1,3-dioxoisoindol-2-yl)imidazol-1-yl]ethyl]pyrrolidin-3-yl] methanesulfonate?
[1-[2-[2-(1,3-dioxoisoindol-2-yl)imidazol-1-yl]ethyl]pyrrolidin-3-yl] methanesulfonate has a molecular weight of 404.45 g/mol, XLogP of 0.73, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[2-[2-(1,3-dioxoisoindol-2-yl)imidazol-1-yl]ethyl]pyrrolidin-3-yl] methanesulfonate is sourced from PubChem (CID 139716807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).