C13H18N2O2 — CID 139716822
[1-(pyridin-4-ylmethyl)pyrrolidin-2-yl]methyl acetate (PubChem CID 139716822) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is [1-(pyridin-4-ylmethyl)pyrrolidin-2-yl]methyl acetate.
| Compound Name | [1-(pyridin-4-ylmethyl)pyrrolidin-2-yl]methyl acetate |
|---|---|
| PubChem CID | 139716822 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | [1-(pyridin-4-ylmethyl)pyrrolidin-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1CCCN1Cc1ccncc1 |
| InChI | InChI=1S/C13H18N2O2/c1-11(16)17-10-13-3-2-8-15(13)9-12-4-6-14-7-5-12/h4-7,13H,2-3,8-10H2,1H3 |
| InChIKey | DGIYGTWEOAIGGY-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |