C28H30Br4O4S5 — CID 139719418
S-[2-[1-[2,6-dibromo-4-[3,5-dibromo-4-[1-[2-(2-methylprop-2-enoylsulfanyl)ethylsulfanyl]ethoxy]phenyl]sulfanylphenoxy]ethylsulfanyl]ethyl] 2-methylprop-2-enethioate (PubChem CID 139719418) has the molecular formula C28H30Br4O4S5 and a molecular weight of 910.49 g/mol. Its IUPAC name is S-[2-[1-[2,6-dibromo-4-[3,5-dibromo-4-[1-[2-(2-methylprop-2-enoylsulfanyl)ethylsulfanyl]ethoxy]phenyl]sulfanylphenoxy]ethylsulfanyl]ethyl] 2-methylprop-2-enethioate.
| Compound Name | S-[2-[1-[2,6-dibromo-4-[3,5-dibromo-4-[1-[2-(2-methylprop-2-enoylsulfanyl)ethylsulfanyl]ethoxy]phenyl]sulfanylphenoxy]ethylsulfanyl]ethyl] 2-methylprop-2-enethioate |
|---|---|
| PubChem CID | 139719418 |
| Molecular Formula | C28H30Br4O4S5 |
| Molecular Weight | 910.49 g/mol |
| Exact Mass | 905.75 |
| IUPAC Name | S-[2-[1-[2,6-dibromo-4-[3,5-dibromo-4-[1-[2-(2-methylprop-2-enoylsulfanyl)ethylsulfanyl]ethoxy]phenyl]sulfanylphenoxy]ethylsulfanyl]ethyl] 2-methylprop-2-enethioate |
| SMILES | C=C(C)C(=O)SCCSC(C)Oc1c(Br)cc(Sc2cc(Br)c(OC(C)SCCSC(=O)C(=C)C)c(Br)c2)cc1Br |
| InChI | InChI=1S/C28H30Br4O4S5/c1-15(2)27(33)39-9-7-37-17(5)35-25-21(29)11-19(12-22(25)30)41-20-13-23(31)26(24(32)14-20)36-18(6)38-8-10-40-28(34)16(3)4/h11-14,17-18H,1,3,7-10H2,2,4-6H3 |
| InChIKey | WDCVUJJNAMYTQY-UHFFFAOYSA-N |
| XLogP | 11.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 910.49 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|