C20H32N4 — CID 139719684
N-[2-[1-(dimethylamino)cyclohexyl]ethyl]-1-propan-2-ylbenzimidazol-2-amine (PubChem CID 139719684) has the molecular formula C20H32N4 and a molecular weight of 328.50 g/mol. Its IUPAC name is N-[2-[1-(dimethylamino)cyclohexyl]ethyl]-1-propan-2-ylbenzimidazol-2-amine.
| Compound Name | N-[2-[1-(dimethylamino)cyclohexyl]ethyl]-1-propan-2-ylbenzimidazol-2-amine |
|---|---|
| PubChem CID | 139719684 |
| Molecular Formula | C20H32N4 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.26 |
| IUPAC Name | N-[2-[1-(dimethylamino)cyclohexyl]ethyl]-1-propan-2-ylbenzimidazol-2-amine |
| SMILES | CC(C)n1c(NCCC2(N(C)C)CCCCC2)nc2ccccc21 |
| InChI | InChI=1S/C20H32N4/c1-16(2)24-18-11-7-6-10-17(18)22-19(24)21-15-14-20(23(3)4)12-8-5-9-13-20/h6-7,10-11,16H,5,8-9,12-15H2,1-4H3,(H,21,22) |
| InChIKey | LGEWXFRSFNLLFR-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |