About 2-[(E,4S,5S)-5-azido-4-(4-chlorophenyl)hex-1-enyl]naphthalene
2-[(E,4S,5S)-5-azido-4-(4-chlorophenyl)hex-1-enyl]naphthalene (PubChem CID 139719716) has the molecular formula C22H20ClN3
and a molecular weight of 361.88 g/mol. Its IUPAC name is 2-[(E,4S,5S)-5-azido-4-(4-chlorophenyl)hex-1-enyl]naphthalene.
Molecular Properties
| Compound Name | 2-[(E,4S,5S)-5-azido-4-(4-chlorophenyl)hex-1-enyl]naphthalene |
| PubChem CID | 139719716 |
| Molecular Formula | C22H20ClN3 |
| Molecular Weight | 361.88 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 2-[(E,4S,5S)-5-azido-4-(4-chlorophenyl)hex-1-enyl]naphthalene |
| SMILES | C[C@H](N=[N+]=[N-])[C@@H](C/C=C/c1ccc2ccccc2c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H20ClN3/c1-16(25-26-24)22(19-11-13-21(23)14-12-19)8-4-5-17-9-10-18-6-2-3-7-20(18)15-17/h2-7,9-16,22H,8H2,1H3/b5-4+/t16-,22+/m0/s1 |
| InChIKey | UFAJEXXJSCYSKH-XBQZDBRBSA-N |
| XLogP | 7.38 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 361.88 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E,4S,5S)-5-azido-4-(4-chlorophenyl)hex-1-enyl]naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E,4S,5S)-5-azido-4-(4-chlorophenyl)hex-1-enyl]naphthalene?
The IUPAC name of 2-[(E,4S,5S)-5-azido-4-(4-chlorophenyl)hex-1-enyl]naphthalene (CID 139719716) is 2-[(E,4S,5S)-5-azido-4-(4-chlorophenyl)hex-1-enyl]naphthalene.
What is the SMILES notation for 2-[(E,4S,5S)-5-azido-4-(4-chlorophenyl)hex-1-enyl]naphthalene?
The canonical SMILES for 2-[(E,4S,5S)-5-azido-4-(4-chlorophenyl)hex-1-enyl]naphthalene is C[C@H](N=[N+]=[N-])[C@@H](C/C=C/c1ccc2ccccc2c1)c1ccc(Cl)cc1.
What is the InChIKey of 2-[(E,4S,5S)-5-azido-4-(4-chlorophenyl)hex-1-enyl]naphthalene?
The InChIKey is UFAJEXXJSCYSKH-XBQZDBRBSA-N. The full InChI is InChI=1S/C22H20ClN3/c1-16(25-26-24)22(19-11-13-21(23)14-12-19)8-4-5-17-9-10-18-6-2-3-7-20(18)15-17/h2-7,9-16,22H,8H2,1H3/b5-4+/t16-,22+/m0/s1.
What are the key properties of 2-[(E,4S,5S)-5-azido-4-(4-chlorophenyl)hex-1-enyl]naphthalene?
2-[(E,4S,5S)-5-azido-4-(4-chlorophenyl)hex-1-enyl]naphthalene has a molecular weight of 361.88 g/mol, XLogP of 7.38, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E,4S,5S)-5-azido-4-(4-chlorophenyl)hex-1-enyl]naphthalene is sourced from PubChem (CID 139719716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).