C31H39NO5 — CID 139719971
(2R,4R)-2-[2-[2-[2-[3-methoxy-4-(methoxymethoxy)phenyl]ethyl]phenoxy]ethyl]-1-methyl-4-phenylmethoxypyrrolidine (PubChem CID 139719971) has the molecular formula C31H39NO5 and a molecular weight of 505.66 g/mol. Its IUPAC name is (2R,4R)-2-[2-[2-[2-[3-methoxy-4-(methoxymethoxy)phenyl]ethyl]phenoxy]ethyl]-1-methyl-4-phenylmethoxypyrrolidine.
| Compound Name | (2R,4R)-2-[2-[2-[2-[3-methoxy-4-(methoxymethoxy)phenyl]ethyl]phenoxy]ethyl]-1-methyl-4-phenylmethoxypyrrolidine |
|---|---|
| PubChem CID | 139719971 |
| Molecular Formula | C31H39NO5 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.28 |
| IUPAC Name | (2R,4R)-2-[2-[2-[2-[3-methoxy-4-(methoxymethoxy)phenyl]ethyl]phenoxy]ethyl]-1-methyl-4-phenylmethoxypyrrolidine |
| SMILES | COCOc1ccc(CCc2ccccc2OCC[C@@H]2C[C@@H](OCc3ccccc3)CN2C)cc1OC |
| InChI | InChI=1S/C31H39NO5/c1-32-21-28(36-22-25-9-5-4-6-10-25)20-27(32)17-18-35-29-12-8-7-11-26(29)15-13-24-14-16-30(37-23-33-2)31(19-24)34-3/h4-12,14,16,19,27-28H,13,15,17-18,20-23H2,1-3H3/t27-,28-/m1/s1 |
| InChIKey | OKGNWQADIASWCU-VSGBNLITSA-N |
| XLogP | 5.52 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|