C31H30F6N2O2 — CID 139719983
2-[(3S,4R,5S,6R)-6-benzhydryl-5-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-azabicyclo[2.2.2]octan-3-yl]acetamide (PubChem CID 139719983) has the molecular formula C31H30F6N2O2 and a molecular weight of 576.58 g/mol. Its IUPAC name is 2-[(3S,4R,5S,6R)-6-benzhydryl-5-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-azabicyclo[2.2.2]octan-3-yl]acetamide.
| Compound Name | 2-[(3S,4R,5S,6R)-6-benzhydryl-5-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-azabicyclo[2.2.2]octan-3-yl]acetamide |
|---|---|
| PubChem CID | 139719983 |
| Molecular Formula | C31H30F6N2O2 |
| Molecular Weight | 576.58 g/mol |
| Exact Mass | 576.22 |
| IUPAC Name | 2-[(3S,4R,5S,6R)-6-benzhydryl-5-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-azabicyclo[2.2.2]octan-3-yl]acetamide |
| SMILES | NC(=O)C[C@@H]1CN2CC[C@H]1[C@H](OCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)[C@H]2C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H30F6N2O2/c32-30(33,34)23-13-19(14-24(16-23)31(35,36)37)18-41-29-25-11-12-39(17-22(25)15-26(38)40)28(29)27(20-7-3-1-4-8-20)21-9-5-2-6-10-21/h1-10,13-14,16,22,25,27-29H,11-12,15,17-18H2,(H2,38,40)/t22-,25-,28-,29+/m1/s1 |
| InChIKey | SATHJQSHCIPIOS-PJKQZJAASA-N |
| XLogP | 6.64 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.58 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |