C14H11BrF3N3O — CID 139721043
1-methyl-6-[4-(trifluoromethyl)phenyl]-7H-imidazo[1,2-a]pyrazin-1-ium-8-one bromide (PubChem CID 139721043) has the molecular formula C14H11BrF3N3O and a molecular weight of 374.16 g/mol. Its IUPAC name is 1-methyl-6-[4-(trifluoromethyl)phenyl]-7H-imidazo[1,2-a]pyrazin-1-ium-8-one bromide.
| Compound Name | 1-methyl-6-[4-(trifluoromethyl)phenyl]-7H-imidazo[1,2-a]pyrazin-1-ium-8-one bromide |
|---|---|
| PubChem CID | 139721043 |
| Molecular Formula | C14H11BrF3N3O |
| Molecular Weight | 374.16 g/mol |
| Exact Mass | 373.00 |
| IUPAC Name | 1-methyl-6-[4-(trifluoromethyl)phenyl]-7H-imidazo[1,2-a]pyrazin-1-ium-8-one bromide |
| SMILES | C[n+]1ccn2cc(-c3ccc(C(F)(F)F)cc3)[nH]c(=O)c21.[Br-] |
| InChI | InChI=1S/C14H10F3N3O.BrH/c1-19-6-7-20-8-11(18-12(21)13(19)20)9-2-4-10(5-3-9)14(15,16)17;/h2-8H,1H3;1H |
| InChIKey | KPBHREQGOQFOIS-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.16 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|