C26H26ClN5O — CID 139721505
N-[(2-chlorophenyl)methyl]-4-[(1-phenylbenzimidazol-2-yl)methyl]piperazine-1-carboxamide (PubChem CID 139721505) has the molecular formula C26H26ClN5O and a molecular weight of 459.98 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-4-[(1-phenylbenzimidazol-2-yl)methyl]piperazine-1-carboxamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-4-[(1-phenylbenzimidazol-2-yl)methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 139721505 |
| Molecular Formula | C26H26ClN5O |
| Molecular Weight | 459.98 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-4-[(1-phenylbenzimidazol-2-yl)methyl]piperazine-1-carboxamide |
| SMILES | O=C(NCc1ccccc1Cl)N1CCN(Cc2nc3ccccc3n2-c2ccccc2)CC1 |
| InChI | InChI=1S/C26H26ClN5O/c27-22-11-5-4-8-20(22)18-28-26(33)31-16-14-30(15-17-31)19-25-29-23-12-6-7-13-24(23)32(25)21-9-2-1-3-10-21/h1-13H,14-19H2,(H,28,33) |
| InChIKey | FPXNYBMGOWAMKA-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.98 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |