C17H26O2SSi — CID 139721712
tert-butyl-dimethyl-[[(2S,5S)-5-phenylsulfanyl-2,5-dihydrofuran-2-yl]methoxy]silane (PubChem CID 139721712) has the molecular formula C17H26O2SSi and a molecular weight of 322.55 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(2S,5S)-5-phenylsulfanyl-2,5-dihydrofuran-2-yl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(2S,5S)-5-phenylsulfanyl-2,5-dihydrofuran-2-yl]methoxy]silane |
|---|---|
| PubChem CID | 139721712 |
| Molecular Formula | C17H26O2SSi |
| Molecular Weight | 322.55 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | tert-butyl-dimethyl-[[(2S,5S)-5-phenylsulfanyl-2,5-dihydrofuran-2-yl]methoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1C=C[C@H](Sc2ccccc2)O1 |
| InChI | InChI=1S/C17H26O2SSi/c1-17(2,3)21(4,5)18-13-14-11-12-16(19-14)20-15-9-7-6-8-10-15/h6-12,14,16H,13H2,1-5H3/t14-,16-/m0/s1 |
| InChIKey | BIPZKCFZRHDJJM-HOCLYGCPSA-N |
| XLogP | 5.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.55 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|