C22H47N — CID 139723221
N,N-dibutyl-12-methyltridecan-1-amine (PubChem CID 139723221) has the molecular formula C22H47N and a molecular weight of 325.63 g/mol. Its IUPAC name is N,N-dibutyl-12-methyltridecan-1-amine.
| Compound Name | N,N-dibutyl-12-methyltridecan-1-amine |
|---|---|
| PubChem CID | 139723221 |
| Molecular Formula | C22H47N |
| Molecular Weight | 325.63 g/mol |
| Exact Mass | 325.37 |
| IUPAC Name | N,N-dibutyl-12-methyltridecan-1-amine |
| SMILES | CCCCN(CCCC)CCCCCCCCCCCC(C)C |
| InChI | InChI=1S/C22H47N/c1-5-7-19-23(20-8-6-2)21-17-15-13-11-9-10-12-14-16-18-22(3)4/h22H,5-21H2,1-4H3 |
| InChIKey | BRMIFUMMHIWQDE-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.63 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|