C18H22ClFN4O — CID 139724125
2-[2-chloro-5-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-6-fluoro-3-methylquinolin-4-yl]acetamide (PubChem CID 139724125) has the molecular formula C18H22ClFN4O and a molecular weight of 364.85 g/mol. Its IUPAC name is 2-[2-chloro-5-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-6-fluoro-3-methylquinolin-4-yl]acetamide.
| Compound Name | 2-[2-chloro-5-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-6-fluoro-3-methylquinolin-4-yl]acetamide |
|---|---|
| PubChem CID | 139724125 |
| Molecular Formula | C18H22ClFN4O |
| Molecular Weight | 364.85 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 2-[2-chloro-5-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-6-fluoro-3-methylquinolin-4-yl]acetamide |
| SMILES | Cc1c(Cl)nc2ccc(F)c(N3C[C@@H](C)N[C@@H](C)C3)c2c1CC(N)=O |
| InChI | InChI=1S/C18H22ClFN4O/c1-9-7-24(8-10(2)22-9)17-13(20)4-5-14-16(17)12(6-15(21)25)11(3)18(19)23-14/h4-5,9-10,22H,6-8H2,1-3H3,(H2,21,25)/t9-,10+ |
| InChIKey | JPTISCAIQWDVIQ-AOOOYVTPSA-N |
| XLogP | 2.55 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.85 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|