C9H14F3N5 — CID 139724197
2-N,2-N-diethyl-6-(2,2,2-trifluoroethyl)-1,3,5-triazine-2,4-diamine (PubChem CID 139724197) has the molecular formula C9H14F3N5 and a molecular weight of 249.24 g/mol. Its IUPAC name is 2-N,2-N-diethyl-6-(2,2,2-trifluoroethyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,2-N-diethyl-6-(2,2,2-trifluoroethyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 139724197 |
| Molecular Formula | C9H14F3N5 |
| Molecular Weight | 249.24 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 2-N,2-N-diethyl-6-(2,2,2-trifluoroethyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCN(CC)c1nc(N)nc(CC(F)(F)F)n1 |
| InChI | InChI=1S/C9H14F3N5/c1-3-17(4-2)8-15-6(5-9(10,11)12)14-7(13)16-8/h3-5H2,1-2H3,(H2,13,14,15,16) |
| InChIKey | ZRNGOGPZKQGHLH-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.24 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |