C18H12ClF4N3O — CID 139724262
2-[6-[2-chloro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-pyridinyl]-4-methylpyrimidine (PubChem CID 139724262) has the molecular formula C18H12ClF4N3O and a molecular weight of 397.76 g/mol. Its IUPAC name is 2-[6-[2-chloro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-pyridinyl]-4-methylpyrimidine.
| Compound Name | 2-[6-[2-chloro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-pyridinyl]-4-methylpyrimidine |
|---|---|
| PubChem CID | 139724262 |
| Molecular Formula | C18H12ClF4N3O |
| Molecular Weight | 397.76 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | 2-[6-[2-chloro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-pyridinyl]-4-methylpyrimidine |
| SMILES | Cc1ccnc(-c2cccc(-c3ccc(OC(F)(F)C(F)F)cc3Cl)n2)n1 |
| InChI | InChI=1S/C18H12ClF4N3O/c1-10-7-8-24-16(25-10)15-4-2-3-14(26-15)12-6-5-11(9-13(12)19)27-18(22,23)17(20)21/h2-9,17H,1H3 |
| InChIKey | PCNGKKKOESKYHH-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.76 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|